C20H21NO2S — CID 129012311
1-(5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine (PubChem CID 129012311) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-(5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine.
| Compound Name | 1-(5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 129012311 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-(5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine |
| SMILES | CC(CC1=C2c3ccccc3S(=O)(=O)C2c2ccccc21)N(C)C |
| InChI | InChI=1S/C20H21NO2S/c1-13(21(2)3)12-17-14-8-4-5-9-15(14)20-19(17)16-10-6-7-11-18(16)24(20,22)23/h4-11,13,20H,12H2,1-3H3 |
| InChIKey | NLKRVSHJFMIDKW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|