C19H18FNO2S — CID 129012307
2-(2-fluoro-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine (PubChem CID 129012307) has the molecular formula C19H18FNO2S and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-(2-fluoro-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(2-fluoro-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 129012307 |
| Molecular Formula | C19H18FNO2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-(2-fluoro-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1=C2c3ccccc3S(=O)(=O)C2c2ccc(F)cc21 |
| InChI | InChI=1S/C19H18FNO2S/c1-21(2)10-9-13-16-11-12(20)7-8-14(16)19-18(13)15-5-3-4-6-17(15)24(19,22)23/h3-8,11,19H,9-10H2,1-2H3 |
| InChIKey | LQYOFDZTKHCRHZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|