C11H16F3NO5 — CID 129015431
N-[(1R,2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-3,3,3-trifluoropropanamide (PubChem CID 129015431) has the molecular formula C11H16F3NO5 and a molecular weight of 299.25 g/mol. Its IUPAC name is N-[(1R,2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[(1R,2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 129015431 |
| Molecular Formula | C11H16F3NO5 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-[(1R,2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-3,3,3-trifluoropropanamide |
| SMILES | O=C(CC(F)(F)F)N[C@@H]1[C@@H](O)[C@@H](O)[C@]2(CO)CC[C@H]1O2 |
| InChI | InChI=1S/C11H16F3NO5/c12-11(13,14)3-6(17)15-7-5-1-2-10(4-16,20-5)9(19)8(7)18/h5,7-9,16,18-19H,1-4H2,(H,15,17)/t5-,7+,8-,9-,10-/m1/s1 |
| InChIKey | STPBRJAQABMUEN-TVVSKHENSA-N |
| XLogP | -0.93 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |