C8H15INO10P — CID 141101287
[(2R,3S,4R,5R,6R)-3,4,6-trihydroxy-2-(hydroxymethyl)-5-[(2-iodoacetyl)amino]oxan-2-yl] dihydrogen phosphate (PubChem CID 141101287) has the molecular formula C8H15INO10P and a molecular weight of 443.08 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4,6-trihydroxy-2-(hydroxymethyl)-5-[(2-iodoacetyl)amino]oxan-2-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4,6-trihydroxy-2-(hydroxymethyl)-5-[(2-iodoacetyl)amino]oxan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 141101287 |
| Molecular Formula | C8H15INO10P |
| Molecular Weight | 443.08 g/mol |
| Exact Mass | 442.95 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4,6-trihydroxy-2-(hydroxymethyl)-5-[(2-iodoacetyl)amino]oxan-2-yl] dihydrogen phosphate |
| SMILES | O=C(CI)N[C@@H]1[C@@H](O)[C@H](O)[C@@](CO)(OP(=O)(O)O)O[C@H]1O |
| InChI | InChI=1S/C8H15INO10P/c9-1-3(12)10-4-5(13)6(14)8(2-11,19-7(4)15)20-21(16,17)18/h4-7,11,13-15H,1-2H2,(H,10,12)(H2,16,17,18)/t4-,5-,6+,7-,8-/m1/s1 |
| InChIKey | WOEKANJSMWSTHW-JAJWTYFOSA-N |
| XLogP | -3.23 |
| TPSA | 186.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.08 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|