C9H17O11P — CID 175427196
[(2S,3S,4R)-3,4-dihydroxy-2-(hydroxymethyl)-5-(2,3,4-trihydroxybutanoyl)oxolan-2-yl]phosphonic acid (PubChem CID 175427196) has the molecular formula C9H17O11P and a molecular weight of 332.20 g/mol. Its IUPAC name is [(2S,3S,4R)-3,4-dihydroxy-2-(hydroxymethyl)-5-(2,3,4-trihydroxybutanoyl)oxolan-2-yl]phosphonic acid.
| Compound Name | [(2S,3S,4R)-3,4-dihydroxy-2-(hydroxymethyl)-5-(2,3,4-trihydroxybutanoyl)oxolan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 175427196 |
| Molecular Formula | C9H17O11P |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | [(2S,3S,4R)-3,4-dihydroxy-2-(hydroxymethyl)-5-(2,3,4-trihydroxybutanoyl)oxolan-2-yl]phosphonic acid |
| SMILES | O=C(C(O)C(O)CO)C1O[C@@](CO)(P(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H17O11P/c10-1-3(12)4(13)5(14)7-6(15)8(16)9(2-11,20-7)21(17,18)19/h3-4,6-8,10-13,15-16H,1-2H2,(H2,17,18,19)/t3?,4?,6-,7?,8-,9-/m0/s1 |
| InChIKey | YYRYTYXKESRYAG-AHFFAZHUSA-N |
| XLogP | -4.74 |
| TPSA | 205.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|