C12H23NO — CID 12902086
(Z)-4-methyl-N,2-di(propan-2-yl)pent-2-enamide (PubChem CID 12902086) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (Z)-4-methyl-N,2-di(propan-2-yl)pent-2-enamide.
| Compound Name | (Z)-4-methyl-N,2-di(propan-2-yl)pent-2-enamide |
|---|---|
| PubChem CID | 12902086 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (Z)-4-methyl-N,2-di(propan-2-yl)pent-2-enamide |
| SMILES | CC(C)/C=C(\C(=O)NC(C)C)C(C)C |
| InChI | InChI=1S/C12H23NO/c1-8(2)7-11(9(3)4)12(14)13-10(5)6/h7-10H,1-6H3,(H,13,14)/b11-7- |
| InChIKey | GADURJKRQBERQU-XFFZJAGNSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|