C18H35N3O5 — CID 129035829
6-[[3-(4-acetamido-2-methylbutan-2-yl)oxy-2,2-dimethylpropanoyl]amino]-2-aminohexanoic acid (PubChem CID 129035829) has the molecular formula C18H35N3O5 and a molecular weight of 373.49 g/mol. Its IUPAC name is 6-[[3-(4-acetamido-2-methylbutan-2-yl)oxy-2,2-dimethylpropanoyl]amino]-2-aminohexanoic acid.
| Compound Name | 6-[[3-(4-acetamido-2-methylbutan-2-yl)oxy-2,2-dimethylpropanoyl]amino]-2-aminohexanoic acid |
|---|---|
| PubChem CID | 129035829 |
| Molecular Formula | C18H35N3O5 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 6-[[3-(4-acetamido-2-methylbutan-2-yl)oxy-2,2-dimethylpropanoyl]amino]-2-aminohexanoic acid |
| SMILES | CC(=O)NCCC(C)(C)OCC(C)(C)C(=O)NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C18H35N3O5/c1-13(22)20-11-9-18(4,5)26-12-17(2,3)16(25)21-10-7-6-8-14(19)15(23)24/h14H,6-12,19H2,1-5H3,(H,20,22)(H,21,25)(H,23,24) |
| InChIKey | UYNDIEKLXAGTOY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|