C11H18N2O — CID 129036624
(2E,4Z)-6-morpholin-4-ylhepta-2,4,6-trien-3-amine (PubChem CID 129036624) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (2E,4Z)-6-morpholin-4-ylhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-6-morpholin-4-ylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 129036624 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (2E,4Z)-6-morpholin-4-ylhepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C=C\C(N)=C/C)N1CCOCC1 |
| InChI | InChI=1S/C11H18N2O/c1-3-11(12)5-4-10(2)13-6-8-14-9-7-13/h3-5H,2,6-9,12H2,1H3/b5-4-,11-3+ |
| InChIKey | LYVDNYJSOSYMRQ-NEPXUXLISA-N |
| XLogP | 1.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|