About 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one
1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one (PubChem CID 129041072) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one |
| PubChem CID | 129041072 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CC12CC(CC(=O)C(C)(C)C)(C1)C2 |
| InChI | InChI=1S/C17H28O2/c1-14(2,3)12(18)7-16-9-17(10-16,11-16)8-13(19)15(4,5)6/h7-11H2,1-6H3 |
| InChIKey | LAVLKHOWOSOMAX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one?
The IUPAC name of 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one (CID 129041072) is 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one is CC(C)(C)C(=O)CC12CC(CC(=O)C(C)(C)C)(C1)C2.
What is the InChIKey of 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one?
The InChIKey is LAVLKHOWOSOMAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-14(2,3)12(18)7-16-9-17(10-16,11-16)8-13(19)15(4,5)6/h7-11H2,1-6H3.
What are the key properties of 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one?
1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one has a molecular weight of 264.41 g/mol, XLogP of 4.17, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,3-dimethyl-2-oxobutyl)-1-bicyclo[1.1.1]pentanyl]-3,3-dimethylbutan-2-one is sourced from PubChem (CID 129041072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).