C10H20O4 — CID 129044482
(2S,5S)-3,4,5-trimethoxy-2,6-dimethyloxane (PubChem CID 129044482) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S,5S)-3,4,5-trimethoxy-2,6-dimethyloxane.
| Compound Name | (2S,5S)-3,4,5-trimethoxy-2,6-dimethyloxane |
|---|---|
| PubChem CID | 129044482 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (2S,5S)-3,4,5-trimethoxy-2,6-dimethyloxane |
| SMILES | COC1C(OC)[C@H](C)OC(C)[C@@H]1OC |
| InChI | InChI=1S/C10H20O4/c1-6-8(11-3)10(13-5)9(12-4)7(2)14-6/h6-10H,1-5H3/t6-,7?,8?,9-,10?/m0/s1 |
| InChIKey | KRSWMLDDQQZSKK-TWZKZPNTSA-N |
| XLogP | 0.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |