C17H28O3 — CID 129047901
2-[1-(3,7-dimethyloct-6-enyl)cyclopentyl]-2-oxoacetic acid (PubChem CID 129047901) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[1-(3,7-dimethyloct-6-enyl)cyclopentyl]-2-oxoacetic acid.
| Compound Name | 2-[1-(3,7-dimethyloct-6-enyl)cyclopentyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 129047901 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-[1-(3,7-dimethyloct-6-enyl)cyclopentyl]-2-oxoacetic acid |
| SMILES | CC(C)=CCCC(C)CCC1(C(=O)C(=O)O)CCCC1 |
| InChI | InChI=1S/C17H28O3/c1-13(2)7-6-8-14(3)9-12-17(10-4-5-11-17)15(18)16(19)20/h7,14H,4-6,8-12H2,1-3H3,(H,19,20) |
| InChIKey | HJEFAJBTWFLBJR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|