C29H35N5O5S — CID 129048304
[[(2S)-4-(tert-butylamino)-1,4-dioxo-1-[2-[(4-phenylpyridine-2-carbonyl)amino]ethylamino]butan-2-yl]amino] 4-methylbenzenesulfinate (PubChem CID 129048304) has the molecular formula C29H35N5O5S and a molecular weight of 565.70 g/mol. Its IUPAC name is [[(2S)-4-(tert-butylamino)-1,4-dioxo-1-[2-[(4-phenylpyridine-2-carbonyl)amino]ethylamino]butan-2-yl]amino] 4-methylbenzenesulfinate.
| Compound Name | [[(2S)-4-(tert-butylamino)-1,4-dioxo-1-[2-[(4-phenylpyridine-2-carbonyl)amino]ethylamino]butan-2-yl]amino] 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 129048304 |
| Molecular Formula | C29H35N5O5S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | [[(2S)-4-(tert-butylamino)-1,4-dioxo-1-[2-[(4-phenylpyridine-2-carbonyl)amino]ethylamino]butan-2-yl]amino] 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)ON[C@@H](CC(=O)NC(C)(C)C)C(=O)NCCNC(=O)c2cc(-c3ccccc3)ccn2)cc1 |
| InChI | InChI=1S/C29H35N5O5S/c1-20-10-12-23(13-11-20)40(38)39-34-25(19-26(35)33-29(2,3)4)28(37)32-17-16-31-27(36)24-18-22(14-15-30-24)21-8-6-5-7-9-21/h5-15,18,25,34H,16-17,19H2,1-4H3,(H,31,36)(H,32,37)(H,33,35)/t25-,40?/m0/s1 |
| InChIKey | UTQFJLYRNUZIIL-VYKQZUBZSA-N |
| XLogP | 2.82 |
| TPSA | 138.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|