C10H17BrO5 — CID 129048700
2-bromo-1,2-bis[2-(hydroxymethyl)oxetan-2-yl]ethanol (PubChem CID 129048700) has the molecular formula C10H17BrO5 and a molecular weight of 297.15 g/mol. Its IUPAC name is 2-bromo-1,2-bis[2-(hydroxymethyl)oxetan-2-yl]ethanol.
| Compound Name | 2-bromo-1,2-bis[2-(hydroxymethyl)oxetan-2-yl]ethanol |
|---|---|
| PubChem CID | 129048700 |
| Molecular Formula | C10H17BrO5 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-bromo-1,2-bis[2-(hydroxymethyl)oxetan-2-yl]ethanol |
| SMILES | OCC1(C(O)C(Br)C2(CO)CCO2)CCO1 |
| InChI | InChI=1S/C10H17BrO5/c11-7(9(5-12)1-3-15-9)8(14)10(6-13)2-4-16-10/h7-8,12-14H,1-6H2 |
| InChIKey | BKTHTEVLTVOUHB-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|