C32H43N5O5 — CID 129054823
4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]-N-[4-[[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]methyl]phenyl]butanamide (PubChem CID 129054823) has the molecular formula C32H43N5O5 and a molecular weight of 577.73 g/mol. Its IUPAC name is 4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]-N-[4-[[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]methyl]phenyl]butanamide.
| Compound Name | 4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]-N-[4-[[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 129054823 |
| Molecular Formula | C32H43N5O5 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.33 |
| IUPAC Name | 4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]-N-[4-[[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]methyl]phenyl]butanamide |
| SMILES | CN(CCCC(=O)Nc1ccc(CNCCc2ccc(O)c3c2OCC(=O)N3)cc1)C(=O)CCN1CC2CCCC2C1 |
| InChI | InChI=1S/C32H43N5O5/c1-36(30(41)14-17-37-19-24-4-2-5-25(24)20-37)16-3-6-28(39)34-26-10-7-22(8-11-26)18-33-15-13-23-9-12-27(38)31-32(23)42-21-29(40)35-31/h7-12,24-25,33,38H,2-6,13-21H2,1H3,(H,34,39)(H,35,40) |
| InChIKey | KAVGCGIBWOKMRQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|