About 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine
2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine (PubChem CID 129057148) has the molecular formula C8H7Cl4N5
and a molecular weight of 314.99 g/mol. Its IUPAC name is 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine.
Molecular Properties
| Compound Name | 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine |
| PubChem CID | 129057148 |
| Molecular Formula | C8H7Cl4N5 |
| Molecular Weight | 314.99 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine |
| SMILES | Clc1cccc(C(Cl)(Cl)Cl)n1.N#CN=C(N)N |
| InChI | InChI=1S/C6H3Cl4N.C2H4N4/c7-5-3-1-2-4(11-5)6(8,9)10;3-1-6-2(4)5/h1-3H;(H4,4,5,6) |
| InChIKey | JAIAABHKXWQYCT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.99 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine?
The IUPAC name of 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine (CID 129057148) is 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine.
What is the SMILES notation for 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine?
The canonical SMILES for 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine is Clc1cccc(C(Cl)(Cl)Cl)n1.N#CN=C(N)N.
What is the InChIKey of 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine?
The InChIKey is JAIAABHKXWQYCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl4N.C2H4N4/c7-5-3-1-2-4(11-5)6(8,9)10;3-1-6-2(4)5/h1-3H;(H4,4,5,6).
What are the key properties of 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine?
2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine has a molecular weight of 314.99 g/mol, XLogP of 2.30, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(trichloromethyl)pyridine;2-cyanoguanidine is sourced from PubChem (CID 129057148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).