C14H19N4O6S+ — CID 129057158
2-[4-amino-3-[4-(dimethylsulfamoyl)phenyl]-1-hydroxy-4-methyl-5-oxopyrazol-1-ium-1-yl]acetic acid (PubChem CID 129057158) has the molecular formula C14H19N4O6S+ and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-[4-amino-3-[4-(dimethylsulfamoyl)phenyl]-1-hydroxy-4-methyl-5-oxopyrazol-1-ium-1-yl]acetic acid.
| Compound Name | 2-[4-amino-3-[4-(dimethylsulfamoyl)phenyl]-1-hydroxy-4-methyl-5-oxopyrazol-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 129057158 |
| Molecular Formula | C14H19N4O6S+ |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-[4-amino-3-[4-(dimethylsulfamoyl)phenyl]-1-hydroxy-4-methyl-5-oxopyrazol-1-ium-1-yl]acetic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(C2=N[N+](O)(CC(=O)O)C(=O)C2(C)N)cc1 |
| InChI | InChI=1S/C14H18N4O6S/c1-14(15)12(16-18(22,13(14)21)8-11(19)20)9-4-6-10(7-5-9)25(23,24)17(2)3/h4-7,22H,8,15H2,1-3H3/p+1 |
| InChIKey | BEOVEBVPWLYHBO-UHFFFAOYSA-O |
| XLogP | -0.81 |
| TPSA | 150.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|