C14H16N4O7S — CID 129057242
[1-(2-amino-2-oxoethyl)-4-methyl-3-(4-methylsulfonylphenyl)-5-oxopyrazol-4-yl]-hydroxycarbamic acid (PubChem CID 129057242) has the molecular formula C14H16N4O7S and a molecular weight of 384.37 g/mol. Its IUPAC name is [1-(2-amino-2-oxoethyl)-4-methyl-3-(4-methylsulfonylphenyl)-5-oxopyrazol-4-yl]-hydroxycarbamic acid.
| Compound Name | [1-(2-amino-2-oxoethyl)-4-methyl-3-(4-methylsulfonylphenyl)-5-oxopyrazol-4-yl]-hydroxycarbamic acid |
|---|---|
| PubChem CID | 129057242 |
| Molecular Formula | C14H16N4O7S |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | [1-(2-amino-2-oxoethyl)-4-methyl-3-(4-methylsulfonylphenyl)-5-oxopyrazol-4-yl]-hydroxycarbamic acid |
| SMILES | CC1(N(O)C(=O)O)C(=O)N(CC(N)=O)N=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H16N4O7S/c1-14(18(23)13(21)22)11(16-17(12(14)20)7-10(15)19)8-3-5-9(6-4-8)26(2,24)25/h3-6,23H,7H2,1-2H3,(H2,15,19)(H,21,22) |
| InChIKey | KIOSRZSFWOFCMA-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 170.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|