C31H33Cl2F2N3O3 — CID 129059645
2-[4-[[3-[(2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]oxiran-2-yl]amino]phenyl]acetic acid (PubChem CID 129059645) has the molecular formula C31H33Cl2F2N3O3 and a molecular weight of 604.53 g/mol. Its IUPAC name is 2-[4-[[3-[(2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]oxiran-2-yl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[3-[(2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]oxiran-2-yl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 129059645 |
| Molecular Formula | C31H33Cl2F2N3O3 |
| Molecular Weight | 604.53 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | 2-[4-[[3-[(2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]oxiran-2-yl]amino]phenyl]acetic acid |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C2OC2Nc2ccc(CC(=O)O)cc2)[C@H](c2cccc(Cl)c2F)[C@@]1(N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C31H33Cl2F2N3O3/c1-30(2,3)15-23-31(36,20-12-9-17(32)14-22(20)34)25(19-5-4-6-21(33)26(19)35)27(38-23)28-29(41-28)37-18-10-7-16(8-11-18)13-24(39)40/h4-12,14,23,25,27-29,37-38H,13,15,36H2,1-3H3,(H,39,40)/t23-,25-,27+,28?,29?,31+/m0/s1 |
| InChIKey | MGXXGVLOKSIHPV-LHEHFCNFSA-N |
| XLogP | 6.45 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|