C26H37Cl2N2O6P — CID 129060854
ethyl (2S)-2-[[[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]methyl-[[(1R)-1-ethoxyethyl]amino]phosphoryl]amino]propanoate (PubChem CID 129060854) has the molecular formula C26H37Cl2N2O6P and a molecular weight of 575.47 g/mol. Its IUPAC name is ethyl (2S)-2-[[[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]methyl-[[(1R)-1-ethoxyethyl]amino]phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]methyl-[[(1R)-1-ethoxyethyl]amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 129060854 |
| Molecular Formula | C26H37Cl2N2O6P |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | ethyl (2S)-2-[[[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]methyl-[[(1R)-1-ethoxyethyl]amino]phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(COc1cc(Cl)c(Cc2ccc(O)c(C(C)C)c2)c(Cl)c1)N[C@@H](C)OCC |
| InChI | InChI=1S/C26H37Cl2N2O6P/c1-7-34-18(6)30-37(33,29-17(5)26(32)35-8-2)15-36-20-13-23(27)22(24(28)14-20)12-19-9-10-25(31)21(11-19)16(3)4/h9-11,13-14,16-18,31H,7-8,12,15H2,1-6H3,(H2,29,30,33)/t17-,18+,37?/m0/s1 |
| InChIKey | FUHHSPCBHSESMP-XTZYKFGESA-N |
| XLogP | 6.46 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|