C16H26N2 — CID 129064362
(1E)-1-[2-[(3E)-hexa-3,5-dien-3-yl]-3-(methylideneamino)cyclopropylidene]-N,2-dimethylbutan-1-amine (PubChem CID 129064362) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (1E)-1-[2-[(3E)-hexa-3,5-dien-3-yl]-3-(methylideneamino)cyclopropylidene]-N,2-dimethylbutan-1-amine.
| Compound Name | (1E)-1-[2-[(3E)-hexa-3,5-dien-3-yl]-3-(methylideneamino)cyclopropylidene]-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 129064362 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (1E)-1-[2-[(3E)-hexa-3,5-dien-3-yl]-3-(methylideneamino)cyclopropylidene]-N,2-dimethylbutan-1-amine |
| SMILES | C=C/C=C(\CC)C1/C(=C(\NC)C(C)CC)C1N=C |
| InChI | InChI=1S/C16H26N2/c1-7-10-12(9-3)13-14(16(13)18-6)15(17-5)11(4)8-2/h7,10-11,13,16-17H,1,6,8-9H2,2-5H3/b12-10+,15-14+ |
| InChIKey | WYJREDPXKPMQFR-CXQIITPCSA-N |
| XLogP | 3.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|