C29H26F4N2O4S — CID 129064543
6-(4-butoxy-2-fluorophenyl)-4-(5-ethylthiophen-2-yl)-2-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-pyridine-3-carboxamide (PubChem CID 129064543) has the molecular formula C29H26F4N2O4S and a molecular weight of 574.60 g/mol. Its IUPAC name is 6-(4-butoxy-2-fluorophenyl)-4-(5-ethylthiophen-2-yl)-2-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-pyridine-3-carboxamide.
| Compound Name | 6-(4-butoxy-2-fluorophenyl)-4-(5-ethylthiophen-2-yl)-2-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129064543 |
| Molecular Formula | C29H26F4N2O4S |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | 6-(4-butoxy-2-fluorophenyl)-4-(5-ethylthiophen-2-yl)-2-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-pyridine-3-carboxamide |
| SMILES | CCCCOc1ccc(-c2cc(-c3ccc(CC)s3)c(C(=O)Nc3ccc(OC(F)(F)F)cc3)c(=O)[nH]2)c(F)c1 |
| InChI | InChI=1S/C29H26F4N2O4S/c1-3-5-14-38-19-10-12-21(23(30)15-19)24-16-22(25-13-11-20(4-2)40-25)26(28(37)35-24)27(36)34-17-6-8-18(9-7-17)39-29(31,32)33/h6-13,15-16H,3-5,14H2,1-2H3,(H,34,36)(H,35,37) |
| InChIKey | FTTIRUJEULXVKC-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|