C30H29ClN2O3 — CID 129064687
6-(4-butoxy-2-chlorophenyl)-N,4-bis(4-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 129064687) has the molecular formula C30H29ClN2O3 and a molecular weight of 501.03 g/mol. Its IUPAC name is 6-(4-butoxy-2-chlorophenyl)-N,4-bis(4-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 6-(4-butoxy-2-chlorophenyl)-N,4-bis(4-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129064687 |
| Molecular Formula | C30H29ClN2O3 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 6-(4-butoxy-2-chlorophenyl)-N,4-bis(4-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCCCOc1ccc(-c2cc(-c3ccc(C)cc3)c(C(=O)Nc3ccc(C)cc3)c(=O)[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C30H29ClN2O3/c1-4-5-16-36-23-14-15-24(26(31)17-23)27-18-25(21-10-6-19(2)7-11-21)28(30(35)33-27)29(34)32-22-12-8-20(3)9-13-22/h6-15,17-18H,4-5,16H2,1-3H3,(H,32,34)(H,33,35) |
| InChIKey | YVIYCJOCZFIVNQ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|