C33H30N2 — CID 129074764
1-N-methyl-2-N-naphthalen-2-yl-2-N-[(1E,3Z)-1-naphthalen-2-ylhexa-1,3,5-trienyl]cyclohexa-1,3-diene-1,2-diamine (PubChem CID 129074764) has the molecular formula C33H30N2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 1-N-methyl-2-N-naphthalen-2-yl-2-N-[(1E,3Z)-1-naphthalen-2-ylhexa-1,3,5-trienyl]cyclohexa-1,3-diene-1,2-diamine.
| Compound Name | 1-N-methyl-2-N-naphthalen-2-yl-2-N-[(1E,3Z)-1-naphthalen-2-ylhexa-1,3,5-trienyl]cyclohexa-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 129074764 |
| Molecular Formula | C33H30N2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 1-N-methyl-2-N-naphthalen-2-yl-2-N-[(1E,3Z)-1-naphthalen-2-ylhexa-1,3,5-trienyl]cyclohexa-1,3-diene-1,2-diamine |
| SMILES | C=C/C=C\C=C(/c1ccc2ccccc2c1)N(C1=C(NC)CCC=C1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H30N2/c1-3-4-5-17-32(29-20-19-25-12-6-8-14-27(25)23-29)35(33-18-11-10-16-31(33)34-2)30-22-21-26-13-7-9-15-28(26)24-30/h3-9,11-15,17-24,34H,1,10,16H2,2H3/b5-4-,32-17+ |
| InChIKey | HLLJDVXNTOJBLL-OPFPILTHSA-N |
| XLogP | 8.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|