C29H22ClNOS — CID 166788003
7-chloro-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-naphthalen-2-ylphenoxathiin-1-amine (PubChem CID 166788003) has the molecular formula C29H22ClNOS and a molecular weight of 468.02 g/mol. Its IUPAC name is 7-chloro-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-naphthalen-2-ylphenoxathiin-1-amine.
| Compound Name | 7-chloro-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-naphthalen-2-ylphenoxathiin-1-amine |
|---|---|
| PubChem CID | 166788003 |
| Molecular Formula | C29H22ClNOS |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 7-chloro-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-naphthalen-2-ylphenoxathiin-1-amine |
| SMILES | C=C/C=C\C=C(/C)N(c1ccc2ccccc2c1)c1cccc2c1Sc1ccc(Cl)cc1O2 |
| InChI | InChI=1S/C29H22ClNOS/c1-3-4-5-9-20(2)31(24-16-14-21-10-6-7-11-22(21)18-24)25-12-8-13-26-29(25)33-28-17-15-23(30)19-27(28)32-26/h3-19H,1H2,2H3/b5-4-,20-9+ |
| InChIKey | ZPYKIBAIDLCDQA-ONTSAHLESA-N |
| XLogP | 9.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|