C27H27N — CID 144884824
N-[(1E,3E,5E,7E)-10-naphthalen-2-ylundeca-1,3,5,7,9-pentaenyl]cyclohexa-1,5-dien-1-amine (PubChem CID 144884824) has the molecular formula C27H27N and a molecular weight of 365.52 g/mol. Its IUPAC name is N-[(1E,3E,5E,7E)-10-naphthalen-2-ylundeca-1,3,5,7,9-pentaenyl]cyclohexa-1,5-dien-1-amine.
| Compound Name | N-[(1E,3E,5E,7E)-10-naphthalen-2-ylundeca-1,3,5,7,9-pentaenyl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 144884824 |
| Molecular Formula | C27H27N |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[(1E,3E,5E,7E)-10-naphthalen-2-ylundeca-1,3,5,7,9-pentaenyl]cyclohexa-1,5-dien-1-amine |
| SMILES | CC(=C/C=C/C=C/C=C/C=C/NC1=CCCC=C1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H27N/c1-23(25-20-19-24-15-11-12-16-26(24)22-25)14-8-5-3-2-4-6-13-21-28-27-17-9-7-10-18-27/h2-6,8-9,11-22,28H,7,10H2,1H3/b3-2+,6-4+,8-5+,21-13+,23-14? |
| InChIKey | MPOCAVIUKZWFJP-NLJNXJEKSA-N |
| XLogP | 7.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|