C18H18N4O2 — CID 129076574
4-amino-N-[2-(2-methylpropanoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide (PubChem CID 129076574) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 4-amino-N-[2-(2-methylpropanoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide.
| Compound Name | 4-amino-N-[2-(2-methylpropanoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 129076574 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-amino-N-[2-(2-methylpropanoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide |
| SMILES | CC(C)C(=O)c1cc2cc(NC(=O)c3ccc(N)cc3)cnc2[nH]1 |
| InChI | InChI=1S/C18H18N4O2/c1-10(2)16(23)15-8-12-7-14(9-20-17(12)22-15)21-18(24)11-3-5-13(19)6-4-11/h3-10H,19H2,1-2H3,(H,20,22)(H,21,24) |
| InChIKey | MGORKAQZHALGGT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|