C5H7F2N — CID 129078665
1,2-difluoro-3-azabicyclo[3.1.0]hexane (PubChem CID 129078665) has the molecular formula C5H7F2N and a molecular weight of 119.11 g/mol. Its IUPAC name is 1,2-difluoro-3-azabicyclo[3.1.0]hexane.
| Compound Name | 1,2-difluoro-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 129078665 |
| Molecular Formula | C5H7F2N |
| Molecular Weight | 119.11 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | 1,2-difluoro-3-azabicyclo[3.1.0]hexane |
| SMILES | FC1NCC2CC21F |
| InChI | InChI=1S/C5H7F2N/c6-4-5(7)1-3(5)2-8-4/h3-4,8H,1-2H2 |
| InChIKey | OCXCEXNCDQLQAE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.11 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|