C7H7IN4 — CID 129081940
4-amino-6-[(1S)-1-iodoethyl]pyrimidine-5-carbonitrile (PubChem CID 129081940) has the molecular formula C7H7IN4 and a molecular weight of 274.06 g/mol. Its IUPAC name is 4-amino-6-[(1S)-1-iodoethyl]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-[(1S)-1-iodoethyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 129081940 |
| Molecular Formula | C7H7IN4 |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 4-amino-6-[(1S)-1-iodoethyl]pyrimidine-5-carbonitrile |
| SMILES | C[C@H](I)c1ncnc(N)c1C#N |
| InChI | InChI=1S/C7H7IN4/c1-4(8)6-5(2-9)7(10)12-3-11-6/h3-4H,1H3,(H2,10,11,12)/t4-/m0/s1 |
| InChIKey | AKYGDRFSWLWPBT-BYPYZUCNSA-N |
| XLogP | 1.43 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|