C26H50N4O3 — CID 129086942
2-[2-[bis(2-ethylhexyl)amino]ethoxy]ethyl 2-amino-3-(1H-imidazol-5-yl)propanoate (PubChem CID 129086942) has the molecular formula C26H50N4O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is 2-[2-[bis(2-ethylhexyl)amino]ethoxy]ethyl 2-amino-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | 2-[2-[bis(2-ethylhexyl)amino]ethoxy]ethyl 2-amino-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 129086942 |
| Molecular Formula | C26H50N4O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.39 |
| IUPAC Name | 2-[2-[bis(2-ethylhexyl)amino]ethoxy]ethyl 2-amino-3-(1H-imidazol-5-yl)propanoate |
| SMILES | CCCCC(CC)CN(CCOCCOC(=O)C(N)Cc1cnc[nH]1)CC(CC)CCCC |
| InChI | InChI=1S/C26H50N4O3/c1-5-9-11-22(7-3)19-30(20-23(8-4)12-10-6-2)13-14-32-15-16-33-26(31)25(27)17-24-18-28-21-29-24/h18,21-23,25H,5-17,19-20,27H2,1-4H3,(H,28,29) |
| InChIKey | ZDCGYNUXWWJDAU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|