C16H20FNO5 — CID 129100386
7-[[(2R)-4-fluoro-3,6-dihydroxy-5-methoxyhexan-2-yl]amino]chromen-2-one (PubChem CID 129100386) has the molecular formula C16H20FNO5 and a molecular weight of 325.34 g/mol. Its IUPAC name is 7-[[(2R)-4-fluoro-3,6-dihydroxy-5-methoxyhexan-2-yl]amino]chromen-2-one.
| Compound Name | 7-[[(2R)-4-fluoro-3,6-dihydroxy-5-methoxyhexan-2-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 129100386 |
| Molecular Formula | C16H20FNO5 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 7-[[(2R)-4-fluoro-3,6-dihydroxy-5-methoxyhexan-2-yl]amino]chromen-2-one |
| SMILES | COC(CO)C(F)C(O)[C@@H](C)Nc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C16H20FNO5/c1-9(16(21)15(17)13(8-19)22-2)18-11-5-3-10-4-6-14(20)23-12(10)7-11/h3-7,9,13,15-16,18-19,21H,8H2,1-2H3/t9-,13?,15?,16?/m1/s1 |
| InChIKey | PKOSPEZGINBWDS-NBJXOHOASA-N |
| XLogP | 1.30 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|