C15H19NO7 — CID 118450168
7-[[(2S,4R)-1,3,4,5,6-pentahydroxyhexan-2-yl]amino]chromen-2-one (PubChem CID 118450168) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is 7-[[(2S,4R)-1,3,4,5,6-pentahydroxyhexan-2-yl]amino]chromen-2-one.
| Compound Name | 7-[[(2S,4R)-1,3,4,5,6-pentahydroxyhexan-2-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 118450168 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 7-[[(2S,4R)-1,3,4,5,6-pentahydroxyhexan-2-yl]amino]chromen-2-one |
| SMILES | O=c1ccc2ccc(N[C@@H](CO)C(O)[C@@H](O)C(O)CO)cc2o1 |
| InChI | InChI=1S/C15H19NO7/c17-6-10(14(21)15(22)11(19)7-18)16-9-3-1-8-2-4-13(20)23-12(8)5-9/h1-5,10-11,14-19,21-22H,6-7H2/t10-,11?,14?,15-/m0/s1 |
| InChIKey | VOKZMIGQYBJOGQ-RBJWDRSHSA-N |
| XLogP | -1.36 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|