C17H21NO7 — CID 126563825
(2R,3R,4S,5R)-2-[(3,4-dimethyl-2-oxochromen-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal (PubChem CID 126563825) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[(3,4-dimethyl-2-oxochromen-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2R,3R,4S,5R)-2-[(3,4-dimethyl-2-oxochromen-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 126563825 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (2R,3R,4S,5R)-2-[(3,4-dimethyl-2-oxochromen-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal |
| SMILES | Cc1c(C)c2ccc(N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO)cc2oc1=O |
| InChI | InChI=1S/C17H21NO7/c1-8-9(2)17(24)25-14-5-10(3-4-11(8)14)18-12(6-19)15(22)16(23)13(21)7-20/h3-6,12-13,15-16,18,20-23H,7H2,1-2H3/t12-,13+,15+,16+/m0/s1 |
| InChIKey | OUNGJPDZNUBITG-SJXGUFTOSA-N |
| XLogP | -0.54 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|