C20H20F3N3O6 — CID 126563973
(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[[2-oxo-3-(1H-pyrrol-2-yl)-4-(trifluoromethyl)-1H-quinolin-7-yl]amino]hexanal (PubChem CID 126563973) has the molecular formula C20H20F3N3O6 and a molecular weight of 455.39 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[[2-oxo-3-(1H-pyrrol-2-yl)-4-(trifluoromethyl)-1H-quinolin-7-yl]amino]hexanal.
| Compound Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[[2-oxo-3-(1H-pyrrol-2-yl)-4-(trifluoromethyl)-1H-quinolin-7-yl]amino]hexanal |
|---|---|
| PubChem CID | 126563973 |
| Molecular Formula | C20H20F3N3O6 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[[2-oxo-3-(1H-pyrrol-2-yl)-4-(trifluoromethyl)-1H-quinolin-7-yl]amino]hexanal |
| SMILES | O=C[C@H](Nc1ccc2c(C(F)(F)F)c(-c3ccc[nH]3)c(=O)[nH]c2c1)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C20H20F3N3O6/c21-20(22,23)16-10-4-3-9(25-13(7-27)17(30)18(31)14(29)8-28)6-12(10)26-19(32)15(16)11-2-1-5-24-11/h1-7,13-14,17-18,24-25,28-31H,8H2,(H,26,32)/t13-,14+,17+,18+/m0/s1 |
| InChIKey | MUHQTRJHWPSPSC-MJSCVDMRSA-N |
| XLogP | 0.60 |
| TPSA | 158.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|