C16H20N2O6 — CID 126563814
(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[(3-methyl-2-oxo-1H-quinolin-7-yl)amino]hexanal (PubChem CID 126563814) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[(3-methyl-2-oxo-1H-quinolin-7-yl)amino]hexanal.
| Compound Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[(3-methyl-2-oxo-1H-quinolin-7-yl)amino]hexanal |
|---|---|
| PubChem CID | 126563814 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[(3-methyl-2-oxo-1H-quinolin-7-yl)amino]hexanal |
| SMILES | Cc1cc2ccc(N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO)cc2[nH]c1=O |
| InChI | InChI=1S/C16H20N2O6/c1-8-4-9-2-3-10(5-11(9)18-16(8)24)17-12(6-19)14(22)15(23)13(21)7-20/h2-6,12-15,17,20-23H,7H2,1H3,(H,18,24)/t12-,13+,14+,15+/m0/s1 |
| InChIKey | LJLBPZOJMGAVJX-GBJTYRQASA-N |
| XLogP | -1.11 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|