C18H22N2O6 — CID 140877823
(2R,3R,4S,5R)-2-[deuterio-(2-oxo-4-prop-1-enyl-1H-quinolin-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal (PubChem CID 140877823) has the molecular formula C18H22N2O6 and a molecular weight of 363.39 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[deuterio-(2-oxo-4-prop-1-enyl-1H-quinolin-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2R,3R,4S,5R)-2-[deuterio-(2-oxo-4-prop-1-enyl-1H-quinolin-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 140877823 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-[deuterio-(2-oxo-4-prop-1-enyl-1H-quinolin-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal |
| SMILES | [2H]N(c1ccc2c(C=CC)cc(=O)[nH]c2c1)[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H22N2O6/c1-2-3-10-6-16(24)20-13-7-11(4-5-12(10)13)19-14(8-21)17(25)18(26)15(23)9-22/h2-8,14-15,17-19,22-23,25-26H,9H2,1H3,(H,20,24)/t14-,15+,17+,18+/m0/s1/i/hD |
| InChIKey | LRZKLWLRGJGFHN-GQPYVBPSSA-N |
| XLogP | -0.38 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|