C18H21NO8 — CID 126563863
(2S,3S,4R,5S)-2-[(4-acetyl-3-methyl-2-oxochromen-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal (PubChem CID 126563863) has the molecular formula C18H21NO8 and a molecular weight of 379.37 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2-[(4-acetyl-3-methyl-2-oxochromen-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2S,3S,4R,5S)-2-[(4-acetyl-3-methyl-2-oxochromen-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 126563863 |
| Molecular Formula | C18H21NO8 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (2S,3S,4R,5S)-2-[(4-acetyl-3-methyl-2-oxochromen-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal |
| SMILES | CC(=O)c1c(C)c(=O)oc2cc(N[C@H](C=O)[C@H](O)[C@@H](O)[C@@H](O)CO)ccc12 |
| InChI | InChI=1S/C18H21NO8/c1-8-15(9(2)22)11-4-3-10(5-14(11)27-18(8)26)19-12(6-20)16(24)17(25)13(23)7-21/h3-6,12-13,16-17,19,21,23-25H,7H2,1-2H3/t12-,13+,16+,17+/m1/s1 |
| InChIKey | NWTUAMWRYPAABU-OQUILHJVSA-N |
| XLogP | -0.64 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|