C20H20N2O7 — CID 126563908
(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[(2-oxo-3-pyridin-2-ylchromen-7-yl)amino]hexanal (PubChem CID 126563908) has the molecular formula C20H20N2O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[(2-oxo-3-pyridin-2-ylchromen-7-yl)amino]hexanal.
| Compound Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[(2-oxo-3-pyridin-2-ylchromen-7-yl)amino]hexanal |
|---|---|
| PubChem CID | 126563908 |
| Molecular Formula | C20H20N2O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[(2-oxo-3-pyridin-2-ylchromen-7-yl)amino]hexanal |
| SMILES | O=C[C@H](Nc1ccc2cc(-c3ccccn3)c(=O)oc2c1)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C20H20N2O7/c23-9-15(18(26)19(27)16(25)10-24)22-12-5-4-11-7-13(14-3-1-2-6-21-14)20(28)29-17(11)8-12/h1-9,15-16,18-19,22,24-27H,10H2/t15-,16+,18+,19+/m0/s1 |
| InChIKey | BNMSVXPWHPDCMK-QFHJOOASSA-N |
| XLogP | -0.09 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|