C20H22N2O6S — CID 126563812
(2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-2-[(4-methyl-2-oxo-3-thiophen-2-yl-1H-quinolin-7-yl)amino]hexanal (PubChem CID 126563812) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is (2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-2-[(4-methyl-2-oxo-3-thiophen-2-yl-1H-quinolin-7-yl)amino]hexanal.
| Compound Name | (2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-2-[(4-methyl-2-oxo-3-thiophen-2-yl-1H-quinolin-7-yl)amino]hexanal |
|---|---|
| PubChem CID | 126563812 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-2-[(4-methyl-2-oxo-3-thiophen-2-yl-1H-quinolin-7-yl)amino]hexanal |
| SMILES | Cc1c(-c2cccs2)c(=O)[nH]c2cc(N[C@H](C=O)[C@H](O)[C@@H](O)[C@@H](O)CO)ccc12 |
| InChI | InChI=1S/C20H22N2O6S/c1-10-12-5-4-11(21-14(8-23)18(26)19(27)15(25)9-24)7-13(12)22-20(28)17(10)16-3-2-6-29-16/h2-8,14-15,18-19,21,24-27H,9H2,1H3,(H,22,28)/t14-,15+,18+,19+/m1/s1 |
| InChIKey | NNCCSRPPRKYJBM-PDWMJMLSSA-N |
| XLogP | 0.62 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|