C21H42N2 — CID 129103619
3-N-tert-butyl-2-N-(2,2-dimethyl-3-methylideneoctan-4-yl)-4-methylpent-1-ene-2,3-diamine (PubChem CID 129103619) has the molecular formula C21H42N2 and a molecular weight of 322.58 g/mol. Its IUPAC name is 3-N-tert-butyl-2-N-(2,2-dimethyl-3-methylideneoctan-4-yl)-4-methylpent-1-ene-2,3-diamine.
| Compound Name | 3-N-tert-butyl-2-N-(2,2-dimethyl-3-methylideneoctan-4-yl)-4-methylpent-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 129103619 |
| Molecular Formula | C21H42N2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.33 |
| IUPAC Name | 3-N-tert-butyl-2-N-(2,2-dimethyl-3-methylideneoctan-4-yl)-4-methylpent-1-ene-2,3-diamine |
| SMILES | C=C(NC(CCCC)C(=C)C(C)(C)C)C(NC(C)(C)C)C(C)C |
| InChI | InChI=1S/C21H42N2/c1-12-13-14-18(16(4)20(6,7)8)22-17(5)19(15(2)3)23-21(9,10)11/h15,18-19,22-23H,4-5,12-14H2,1-3,6-11H3 |
| InChIKey | YDSRKTNRLSXSEB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|