C25H24N3OS+ — CID 129106547
(5S)-5-benzyl-2-methylsulfanyl-6,6-diphenyl-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium (PubChem CID 129106547) has the molecular formula C25H24N3OS+ and a molecular weight of 414.55 g/mol. Its IUPAC name is (5S)-5-benzyl-2-methylsulfanyl-6,6-diphenyl-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium.
| Compound Name | (5S)-5-benzyl-2-methylsulfanyl-6,6-diphenyl-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
|---|---|
| PubChem CID | 129106547 |
| Molecular Formula | C25H24N3OS+ |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (5S)-5-benzyl-2-methylsulfanyl-6,6-diphenyl-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
| SMILES | CSn1c[n+]2c(n1)COC(c1ccccc1)(c1ccccc1)[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C25H24N3OS/c1-30-28-19-27-23(17-20-11-5-2-6-12-20)25(29-18-24(27)26-28,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,19,23H,17-18H2,1H3/q+1/t23-/m0/s1 |
| InChIKey | CSUNLYIZIVJYOC-QHCPKHFHSA-N |
| XLogP | 4.55 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|