C23H28O4 — CID 129109208
5-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxymethyl]cyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 129109208) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 5-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxymethyl]cyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 5-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxymethyl]cyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 129109208 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 5-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxymethyl]cyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CCCCCCc1cc2c(cc1OCC1C=CC=C(C(=O)O)C1)C(=O)CC2 |
| InChI | InChI=1S/C23H28O4/c1-2-3-4-5-8-18-13-17-10-11-21(24)20(17)14-22(18)27-15-16-7-6-9-19(12-16)23(25)26/h6-7,9,13-14,16H,2-5,8,10-12,15H2,1H3,(H,25,26) |
| InChIKey | MKPWGRCXLVPQBD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|