C16H21ClN4O4 — CID 129112208
6-amino-5-[(4-chlorophenyl)methylamino]-3-[2-(2-hydroxyethoxy)ethyl]-1-methylpyrimidine-2,4-dione (PubChem CID 129112208) has the molecular formula C16H21ClN4O4 and a molecular weight of 368.82 g/mol. Its IUPAC name is 6-amino-5-[(4-chlorophenyl)methylamino]-3-[2-(2-hydroxyethoxy)ethyl]-1-methylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[(4-chlorophenyl)methylamino]-3-[2-(2-hydroxyethoxy)ethyl]-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129112208 |
| Molecular Formula | C16H21ClN4O4 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 6-amino-5-[(4-chlorophenyl)methylamino]-3-[2-(2-hydroxyethoxy)ethyl]-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1c(N)c(NCc2ccc(Cl)cc2)c(=O)n(CCOCCO)c1=O |
| InChI | InChI=1S/C16H21ClN4O4/c1-20-14(18)13(19-10-11-2-4-12(17)5-3-11)15(23)21(16(20)24)6-8-25-9-7-22/h2-5,19,22H,6-10,18H2,1H3 |
| InChIKey | IPKYDGHJDBLUHI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|