C17H27F3O4 — CID 129118466
[3-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cyclobutyl] 2-methylprop-2-enoate (PubChem CID 129118466) has the molecular formula C17H27F3O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is [3-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cyclobutyl] 2-methylprop-2-enoate.
| Compound Name | [3-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cyclobutyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118466 |
| Molecular Formula | C17H27F3O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [3-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cyclobutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC(C(CC)(CC)OCC(C)(O)C(F)(F)F)C1 |
| InChI | InChI=1S/C17H27F3O4/c1-6-16(7-2,23-10-15(5,22)17(18,19)20)12-8-13(9-12)24-14(21)11(3)4/h12-13,22H,3,6-10H2,1-2,4-5H3 |
| InChIKey | AIQVRPFDOPGDDC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|