About 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate
2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate (PubChem CID 129119303) has the molecular formula C12H18O4S3
and a molecular weight of 322.47 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate |
| PubChem CID | 129119303 |
| Molecular Formula | C12H18O4S3 |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate |
| SMILES | C=CC(=O)OCCOC(=O)C(C)(C)SC(=S)SCC |
| InChI | InChI=1S/C12H18O4S3/c1-5-9(13)15-7-8-16-10(14)12(3,4)19-11(17)18-6-2/h5H,1,6-8H2,2-4H3 |
| InChIKey | CPEJVEQLVZMNJN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate?
The IUPAC name of 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate (CID 129119303) is 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate.
What is the SMILES notation for 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate?
The canonical SMILES for 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate is C=CC(=O)OCCOC(=O)C(C)(C)SC(=S)SCC.
What is the InChIKey of 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate?
The InChIKey is CPEJVEQLVZMNJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4S3/c1-5-9(13)15-7-8-16-10(14)12(3,4)19-11(17)18-6-2/h5H,1,6-8H2,2-4H3.
What are the key properties of 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate?
2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate has a molecular weight of 322.47 g/mol, XLogP of 2.81, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxyethyl 2-ethylsulfanylcarbothioylsulfanyl-2-methylpropanoate is sourced from PubChem (CID 129119303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).