C24H32N4O3S2 — CID 129125098
(2R)-3-(2-aminoethylsulfanyl)-1-(4-methylsulfonylpiperazin-1-yl)-2-[1-(4-phenylphenyl)ethenylamino]propan-1-one (PubChem CID 129125098) has the molecular formula C24H32N4O3S2 and a molecular weight of 488.68 g/mol. Its IUPAC name is (2R)-3-(2-aminoethylsulfanyl)-1-(4-methylsulfonylpiperazin-1-yl)-2-[1-(4-phenylphenyl)ethenylamino]propan-1-one.
| Compound Name | (2R)-3-(2-aminoethylsulfanyl)-1-(4-methylsulfonylpiperazin-1-yl)-2-[1-(4-phenylphenyl)ethenylamino]propan-1-one |
|---|---|
| PubChem CID | 129125098 |
| Molecular Formula | C24H32N4O3S2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (2R)-3-(2-aminoethylsulfanyl)-1-(4-methylsulfonylpiperazin-1-yl)-2-[1-(4-phenylphenyl)ethenylamino]propan-1-one |
| SMILES | C=C(N[C@@H](CSCCN)C(=O)N1CCN(S(C)(=O)=O)CC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H32N4O3S2/c1-19(20-8-10-22(11-9-20)21-6-4-3-5-7-21)26-23(18-32-17-12-25)24(29)27-13-15-28(16-14-27)33(2,30)31/h3-11,23,26H,1,12-18,25H2,2H3/t23-/m0/s1 |
| InChIKey | AFSLRTWAVSIJLE-QHCPKHFHSA-N |
| XLogP | 2.08 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|