C16H14Cl2N4O — CID 12912720
2-[3,6-bis(2-chlorophenyl)-1H-1,2,4,5-tetrazin-2-yl]ethanol (PubChem CID 12912720) has the molecular formula C16H14Cl2N4O and a molecular weight of 349.22 g/mol. Its IUPAC name is 2-[3,6-bis(2-chlorophenyl)-1H-1,2,4,5-tetrazin-2-yl]ethanol.
| Compound Name | 2-[3,6-bis(2-chlorophenyl)-1H-1,2,4,5-tetrazin-2-yl]ethanol |
|---|---|
| PubChem CID | 12912720 |
| Molecular Formula | C16H14Cl2N4O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-[3,6-bis(2-chlorophenyl)-1H-1,2,4,5-tetrazin-2-yl]ethanol |
| SMILES | OCCN1NC(c2ccccc2Cl)=NN=C1c1ccccc1Cl |
| InChI | InChI=1S/C16H14Cl2N4O/c17-13-7-3-1-5-11(13)15-19-20-16(22(21-15)9-10-23)12-6-2-4-8-14(12)18/h1-8,23H,9-10H2,(H,19,21) |
| InChIKey | NDTDJGMTKWQXSH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |