C9H6Cl3N3 — CID 162681210
2,6-dichloro-4-(2-chlorophenyl)-1H-triazine (PubChem CID 162681210) has the molecular formula C9H6Cl3N3 and a molecular weight of 262.53 g/mol. Its IUPAC name is 2,6-dichloro-4-(2-chlorophenyl)-1H-triazine.
| Compound Name | 2,6-dichloro-4-(2-chlorophenyl)-1H-triazine |
|---|---|
| PubChem CID | 162681210 |
| Molecular Formula | C9H6Cl3N3 |
| Molecular Weight | 262.53 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 2,6-dichloro-4-(2-chlorophenyl)-1H-triazine |
| SMILES | ClC1=CC(c2ccccc2Cl)=NN(Cl)N1 |
| InChI | InChI=1S/C9H6Cl3N3/c10-7-4-2-1-3-6(7)8-5-9(11)14-15(12)13-8/h1-5,14H |
| InChIKey | VSVTZPOFSFKHFD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|