C37H36Cl3N3O7S — CID 129131429
(2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[4-[[2,6-dichloro-4-(4-methyl-4-sulfanylpentoxy)benzoyl]amino]phenyl]propanoic acid (PubChem CID 129131429) has the molecular formula C37H36Cl3N3O7S and a molecular weight of 773.13 g/mol. Its IUPAC name is (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[4-[[2,6-dichloro-4-(4-methyl-4-sulfanylpentoxy)benzoyl]amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[4-[[2,6-dichloro-4-(4-methyl-4-sulfanylpentoxy)benzoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 129131429 |
| Molecular Formula | C37H36Cl3N3O7S |
| Molecular Weight | 773.13 g/mol |
| Exact Mass | 771.13 |
| IUPAC Name | (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[4-[[2,6-dichloro-4-(4-methyl-4-sulfanylpentoxy)benzoyl]amino]phenyl]propanoic acid |
| SMILES | CC(C)(S)CCCOc1cc(Cl)c(C(=O)Nc2ccc(C[C@H](NC(=O)c3ccc(C(=O)NCc4cccc(O)c4)cc3Cl)C(=O)O)cc2)c(Cl)c1 |
| InChI | InChI=1S/C37H36Cl3N3O7S/c1-37(2,51)13-4-14-50-26-18-29(39)32(30(40)19-26)35(47)42-24-10-7-21(8-11-24)16-31(36(48)49)43-34(46)27-12-9-23(17-28(27)38)33(45)41-20-22-5-3-6-25(44)15-22/h3,5-12,15,17-19,31,44,51H,4,13-14,16,20H2,1-2H3,(H,41,45)(H,42,47)(H,43,46)(H,48,49)/t31-/m0/s1 |
| InChIKey | IHQLVQIWYLPUOR-HKBQPEDESA-N |
| XLogP | 7.83 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.13 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|