C30H32ClN3O7 — CID 68819857
(2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(4-pentoxybenzoyl)hydrazinyl]propanoic acid (PubChem CID 68819857) has the molecular formula C30H32ClN3O7 and a molecular weight of 582.05 g/mol. Its IUPAC name is (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(4-pentoxybenzoyl)hydrazinyl]propanoic acid.
| Compound Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(4-pentoxybenzoyl)hydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 68819857 |
| Molecular Formula | C30H32ClN3O7 |
| Molecular Weight | 582.05 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(4-pentoxybenzoyl)hydrazinyl]propanoic acid |
| SMILES | CCCCCOc1ccc(C(=O)N(N[C@@H](C)C(=O)O)C(=O)c2ccc(C(=O)NCc3cccc(O)c3)cc2Cl)cc1 |
| InChI | InChI=1S/C30H32ClN3O7/c1-3-4-5-15-41-24-12-9-21(10-13-24)28(37)34(33-19(2)30(39)40)29(38)25-14-11-22(17-26(25)31)27(36)32-18-20-7-6-8-23(35)16-20/h6-14,16-17,19,33,35H,3-5,15,18H2,1-2H3,(H,32,36)(H,39,40)/t19-/m0/s1 |
| InChIKey | BWOCVRPMIXSRMO-IBGZPJMESA-N |
| XLogP | 4.80 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.05 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|