C26H30ClN3O6 — CID 68819828
(2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(1-methylcyclohexanecarbonyl)hydrazinyl]propanoic acid (PubChem CID 68819828) has the molecular formula C26H30ClN3O6 and a molecular weight of 515.99 g/mol. Its IUPAC name is (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(1-methylcyclohexanecarbonyl)hydrazinyl]propanoic acid.
| Compound Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(1-methylcyclohexanecarbonyl)hydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 68819828 |
| Molecular Formula | C26H30ClN3O6 |
| Molecular Weight | 515.99 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(1-methylcyclohexanecarbonyl)hydrazinyl]propanoic acid |
| SMILES | C[C@H](NN(C(=O)c1ccc(C(=O)NCc2cccc(O)c2)cc1Cl)C(=O)C1(C)CCCCC1)C(=O)O |
| InChI | InChI=1S/C26H30ClN3O6/c1-16(24(34)35)29-30(25(36)26(2)11-4-3-5-12-26)23(33)20-10-9-18(14-21(20)27)22(32)28-15-17-7-6-8-19(31)13-17/h6-10,13-14,16,29,31H,3-5,11-12,15H2,1-2H3,(H,28,32)(H,34,35)/t16-/m0/s1 |
| InChIKey | XGWFRUJWYANBDR-INIZCTEOSA-N |
| XLogP | 3.89 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.99 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|